C26H37NS — CID 142584088
(2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-(4-methylcyclohexyl)ethenyl]nona-2,4,7-trien-2-amine (PubChem CID 142584088) has the molecular formula C26H37NS and a molecular weight of 395.66 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-(4-methylcyclohexyl)ethenyl]nona-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-(4-methylcyclohexyl)ethenyl]nona-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142584088 |
| Molecular Formula | C26H37NS |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-(4-methylcyclohexyl)ethenyl]nona-2,4,7-trien-2-amine |
| SMILES | C=CSC(=C\C)/C(/C=C(/C=C(\C)NC(=C)C1CCC(C)CC1)C(=C)C=C)=C/C |
| InChI | InChI=1S/C26H37NS/c1-9-20(6)25(18-23(10-2)26(11-3)28-12-4)17-21(7)27-22(8)24-15-13-19(5)14-16-24/h9-12,17-19,24,27H,1,4,6,8,13-16H2,2-3,5,7H3/b21-17+,23-10+,25-18-,26-11- |
| InChIKey | DIRXADYGWZSRPX-AOQCIJNXSA-N |
| XLogP | 8.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|