C31H40F2N2 — CID 142584231
acetylene;(3E,5Z,8Z)-3-N-[cyclobutylidene-(4,4-difluorocyclohexyl)methyl]-8-N-ethenyl-8-N-methyl-5-[(3Z)-penta-1,3-dien-3-yl]deca-3,5,8-trien-1-yne-3,8-diamine (PubChem CID 142584231) has the molecular formula C31H40F2N2 and a molecular weight of 478.67 g/mol. Its IUPAC name is acetylene;(3E,5Z,8Z)-3-N-[cyclobutylidene-(4,4-difluorocyclohexyl)methyl]-8-N-ethenyl-8-N-methyl-5-[(3Z)-penta-1,3-dien-3-yl]deca-3,5,8-trien-1-yne-3,8-diamine.
| Compound Name | acetylene;(3E,5Z,8Z)-3-N-[cyclobutylidene-(4,4-difluorocyclohexyl)methyl]-8-N-ethenyl-8-N-methyl-5-[(3Z)-penta-1,3-dien-3-yl]deca-3,5,8-trien-1-yne-3,8-diamine |
|---|---|
| PubChem CID | 142584231 |
| Molecular Formula | C31H40F2N2 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | acetylene;(3E,5Z,8Z)-3-N-[cyclobutylidene-(4,4-difluorocyclohexyl)methyl]-8-N-ethenyl-8-N-methyl-5-[(3Z)-penta-1,3-dien-3-yl]deca-3,5,8-trien-1-yne-3,8-diamine |
| SMILES | C#C.C#C/C(=C\C(=C\C/C(=C/C)N(C)C=C)\C(C=C)=C/C)NC(=C1CCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C29H38F2N2.C2H2/c1-7-22(8-2)25(15-16-27(10-4)33(6)11-5)21-26(9-3)32-28(23-13-12-14-23)24-17-19-29(30,31)20-18-24;1-2/h3,7-8,10-11,15,21,24,32H,1,5,12-14,16-20H2,2,4,6H3;1-2H/b22-8-,25-15-,26-21+,27-10-; |
| InChIKey | LNPBHXFCMVNZPD-JKFPQWFHSA-N |
| XLogP | 8.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|