C26H46N6 — CID 142584266
(4Z,5E)-4-[3-[amino(methyl)amino]-2-methylidenebut-3-enylidene]-5-ethylidene-N-methylpyridin-2-amine;4-ethenyl-1-(2-methylpropyl)piperidine;methanamine (PubChem CID 142584266) has the molecular formula C26H46N6 and a molecular weight of 442.70 g/mol. Its IUPAC name is (4Z,5E)-4-[3-[amino(methyl)amino]-2-methylidenebut-3-enylidene]-5-ethylidene-N-methylpyridin-2-amine;4-ethenyl-1-(2-methylpropyl)piperidine;methanamine.
| Compound Name | (4Z,5E)-4-[3-[amino(methyl)amino]-2-methylidenebut-3-enylidene]-5-ethylidene-N-methylpyridin-2-amine;4-ethenyl-1-(2-methylpropyl)piperidine;methanamine |
|---|---|
| PubChem CID | 142584266 |
| Molecular Formula | C26H46N6 |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | (4Z,5E)-4-[3-[amino(methyl)amino]-2-methylidenebut-3-enylidene]-5-ethylidene-N-methylpyridin-2-amine;4-ethenyl-1-(2-methylpropyl)piperidine;methanamine |
| SMILES | C=C(/C=c1/cc(NC)nc/c1=C/C)C(=C)N(C)N.C=CC1CCN(CC(C)C)CC1.CN |
| InChI | InChI=1S/C14H20N4.C11H21N.CH5N/c1-6-12-9-17-14(16-4)8-13(12)7-10(2)11(3)18(5)15;1-4-11-5-7-12(8-6-11)9-10(2)3;1-2/h6-9,16H,2-3,15H2,1,4-5H3;4,10-11H,1,5-9H2,2-3H3;2H2,1H3/b12-6-,13-7-;; |
| InChIKey | NTQCRWDNIWFZTB-XCAWBZNRSA-N |
| XLogP | 2.69 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|