About (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine
(5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine (PubChem CID 142584478) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine.
Molecular Properties
| Compound Name | (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine |
| PubChem CID | 142584478 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine |
| SMILES | FC(F)CNC1CC2C=C[C@@H](CC2)C1 |
| InChI | InChI=1S/C11H17F2N/c12-11(13)7-14-10-5-8-1-2-9(6-10)4-3-8/h1-2,8-11,14H,3-7H2/t8-,9?,10?/m0/s1 |
| InChIKey | KKUPSDIWXKOBNW-IDKOKCKLSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine?
The IUPAC name of (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine (CID 142584478) is (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine.
What is the SMILES notation for (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine?
The canonical SMILES for (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine is FC(F)CNC1CC2C=C[C@@H](CC2)C1.
What is the InChIKey of (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine?
The InChIKey is KKUPSDIWXKOBNW-IDKOKCKLSA-N. The full InChI is InChI=1S/C11H17F2N/c12-11(13)7-14-10-5-8-1-2-9(6-10)4-3-8/h1-2,8-11,14H,3-7H2/t8-,9?,10?/m0/s1.
What are the key properties of (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine?
(5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine has a molecular weight of 201.26 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-N-(2,2-difluoroethyl)bicyclo[3.2.2]non-6-en-3-amine is sourced from PubChem (CID 142584478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).