About (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine
(8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine (PubChem CID 142584512) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine.
Molecular Properties
| Compound Name | (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine |
| PubChem CID | 142584512 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine |
| SMILES | CC1=C[C@H](C)C=c2cnc(N)cc2=C1 |
| InChI | InChI=1S/C12H14N2/c1-8-3-9(2)5-11-7-14-12(13)6-10(11)4-8/h3-7,9H,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | SCPZYUABCLHQBB-VIFPVBQESA-N |
| XLogP | 0.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine?
The IUPAC name of (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine (CID 142584512) is (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine.
What is the SMILES notation for (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine?
The canonical SMILES for (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine is CC1=C[C@H](C)C=c2cnc(N)cc2=C1.
What is the InChIKey of (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine?
The InChIKey is SCPZYUABCLHQBB-VIFPVBQESA-N. The full InChI is InChI=1S/C12H14N2/c1-8-3-9(2)5-11-7-14-12(13)6-10(11)4-8/h3-7,9H,13H2,1-2H3/t9-/m0/s1.
What are the key properties of (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine?
(8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine has a molecular weight of 186.26 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-6,8-dimethyl-8H-cyclohepta[c]pyridin-3-amine is sourced from PubChem (CID 142584512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).