About (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine
(Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine (PubChem CID 142584555) has the molecular formula C20H42N2
and a molecular weight of 310.57 g/mol. Its IUPAC name is (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine.
Molecular Properties
| Compound Name | (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine |
| PubChem CID | 142584555 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine |
| SMILES | CN.[H]/N=C/C(C)=C\CCCC(CCC)CCCCCC(C)C |
| InChI | InChI=1S/C19H37N.CH5N/c1-5-11-19(14-8-6-7-12-17(2)3)15-10-9-13-18(4)16-20;1-2/h13,16-17,19-20H,5-12,14-15H2,1-4H3;2H2,1H3/b18-13-,20-16+; |
| InChIKey | NIVQPTYULDWUQS-AOLSGPEFSA-N |
| XLogP | 6.35 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine?
The IUPAC name of (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine (CID 142584555) is (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine.
What is the SMILES notation for (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine?
The canonical SMILES for (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine is CN.[H]/N=C/C(C)=C\CCCC(CCC)CCCCCC(C)C.
What is the InChIKey of (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine?
The InChIKey is NIVQPTYULDWUQS-AOLSGPEFSA-N. The full InChI is InChI=1S/C19H37N.CH5N/c1-5-11-19(14-8-6-7-12-17(2)3)15-10-9-13-18(4)16-20;1-2/h13,16-17,19-20H,5-12,14-15H2,1-4H3;2H2,1H3/b18-13-,20-16+;.
What are the key properties of (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine?
(Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine has a molecular weight of 310.57 g/mol, XLogP of 6.35, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,13-dimethyl-7-propyltetradec-2-en-1-imine;methanamine is sourced from PubChem (CID 142584555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).