C35H55FN2 — CID 142584575
N-[(E)-1-[(3R)-6-ethenyl-3-[2-(2-fluoroethyl)-1,3,4,4a-tetrahydrocyclopenta[c]pyridin-7-yl]-3-methylcyclohexa-1,5-dien-1-yl]but-1-en-2-yl]-2-ethyl-8-methylnonan-1-amine (PubChem CID 142584575) has the molecular formula C35H55FN2 and a molecular weight of 522.84 g/mol. Its IUPAC name is N-[(E)-1-[(3R)-6-ethenyl-3-[2-(2-fluoroethyl)-1,3,4,4a-tetrahydrocyclopenta[c]pyridin-7-yl]-3-methylcyclohexa-1,5-dien-1-yl]but-1-en-2-yl]-2-ethyl-8-methylnonan-1-amine.
| Compound Name | N-[(E)-1-[(3R)-6-ethenyl-3-[2-(2-fluoroethyl)-1,3,4,4a-tetrahydrocyclopenta[c]pyridin-7-yl]-3-methylcyclohexa-1,5-dien-1-yl]but-1-en-2-yl]-2-ethyl-8-methylnonan-1-amine |
|---|---|
| PubChem CID | 142584575 |
| Molecular Formula | C35H55FN2 |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.43 |
| IUPAC Name | N-[(E)-1-[(3R)-6-ethenyl-3-[2-(2-fluoroethyl)-1,3,4,4a-tetrahydrocyclopenta[c]pyridin-7-yl]-3-methylcyclohexa-1,5-dien-1-yl]but-1-en-2-yl]-2-ethyl-8-methylnonan-1-amine |
| SMILES | C=CC1=CC[C@@](C)(C2=C3CN(CCF)CCC3C=C2)C=C1/C=C(\CC)NCC(CC)CCCCCC(C)C |
| InChI | InChI=1S/C35H55FN2/c1-7-28(14-12-10-11-13-27(4)5)25-37-32(9-3)23-31-24-35(6,19-17-29(31)8-2)34-16-15-30-18-21-38(22-20-36)26-33(30)34/h8,15-17,23-24,27-28,30,37H,2,7,9-14,18-22,25-26H2,1,3-6H3/b32-23+/t28?,30?,35-/m1/s1 |
| InChIKey | FREVGNRJYGULCT-DXMZFVAASA-N |
| XLogP | 9.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|