C30H44N2S — CID 142584839
(2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-[4-[(3-methylazetidin-1-yl)methyl]cyclohexyl]ethenyl]nona-2,4,7-trien-2-amine (PubChem CID 142584839) has the molecular formula C30H44N2S and a molecular weight of 464.76 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-[4-[(3-methylazetidin-1-yl)methyl]cyclohexyl]ethenyl]nona-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-[4-[(3-methylazetidin-1-yl)methyl]cyclohexyl]ethenyl]nona-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142584839 |
| Molecular Formula | C30H44N2S |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-[1-[4-[(3-methylazetidin-1-yl)methyl]cyclohexyl]ethenyl]nona-2,4,7-trien-2-amine |
| SMILES | C=CSC(=C\C)/C(/C=C(/C=C(\C)NC(=C)C1CCC(CN2CC(C)C2)CC1)C(=C)C=C)=C/C |
| InChI | InChI=1S/C30H44N2S/c1-9-23(6)29(18-27(10-2)30(11-3)33-12-4)17-24(7)31-25(8)28-15-13-26(14-16-28)21-32-19-22(5)20-32/h9-12,17-18,22,26,28,31H,1,4,6,8,13-16,19-21H2,2-3,5,7H3/b24-17+,27-10+,29-18-,30-11- |
| InChIKey | FIDNYPHPOLNOFD-LJFZTVSYSA-N |
| XLogP | 8.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|