C26H41NS — CID 142584865
(4E,6Z,8E,9E)-8-ethylidene-N,3-dimethyl-9-(2-methylprop-1-enylsulfanyl)-6-[(3Z)-penta-1,3-dien-3-yl]trideca-4,6,9-trien-4-amine (PubChem CID 142584865) has the molecular formula C26H41NS and a molecular weight of 399.69 g/mol. Its IUPAC name is (4E,6Z,8E,9E)-8-ethylidene-N,3-dimethyl-9-(2-methylprop-1-enylsulfanyl)-6-[(3Z)-penta-1,3-dien-3-yl]trideca-4,6,9-trien-4-amine.
| Compound Name | (4E,6Z,8E,9E)-8-ethylidene-N,3-dimethyl-9-(2-methylprop-1-enylsulfanyl)-6-[(3Z)-penta-1,3-dien-3-yl]trideca-4,6,9-trien-4-amine |
|---|---|
| PubChem CID | 142584865 |
| Molecular Formula | C26H41NS |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | (4E,6Z,8E,9E)-8-ethylidene-N,3-dimethyl-9-(2-methylprop-1-enylsulfanyl)-6-[(3Z)-penta-1,3-dien-3-yl]trideca-4,6,9-trien-4-amine |
| SMILES | C=CC(=C/C)/C(=C\C(=C/C)\C(=C/CCC)SC=C(C)C)/C=C(/NC)C(C)CC |
| InChI | InChI=1S/C26H41NS/c1-10-15-16-26(28-19-20(6)7)23(14-5)17-24(22(12-3)13-4)18-25(27-9)21(8)11-2/h12-14,16-19,21,27H,3,10-11,15H2,1-2,4-9H3/b22-13-,23-14+,24-17-,25-18+,26-16+ |
| InChIKey | OSNHNIAAKLGXJR-DPOIGTCFSA-N |
| XLogP | 8.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|