C25H26ClN5O3 — CID 142584992
8-(4-amino-2-chlorobenzoyl)-2-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 142584992) has the molecular formula C25H26ClN5O3 and a molecular weight of 479.97 g/mol. Its IUPAC name is 8-(4-amino-2-chlorobenzoyl)-2-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-(4-amino-2-chlorobenzoyl)-2-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 142584992 |
| Molecular Formula | C25H26ClN5O3 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 8-(4-amino-2-chlorobenzoyl)-2-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | COc1cc(N2CCC3(CCN(C(=O)c4ccc(N)cc4Cl)CC3)C2=O)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C25H26ClN5O3/c1-34-22-13-18(3-5-19(22)16-14-28-29-15-16)31-11-8-25(24(31)33)6-9-30(10-7-25)23(32)20-4-2-17(27)12-21(20)26/h2-5,12-15H,6-11,27H2,1H3,(H,28,29) |
| InChIKey | ZUFBQLQUVXJTLZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|