C10H17FN2O — CID 142586264
N-but-1-en-2-yl-3-fluoropiperidine-4-carboxamide (PubChem CID 142586264) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is N-but-1-en-2-yl-3-fluoropiperidine-4-carboxamide.
| Compound Name | N-but-1-en-2-yl-3-fluoropiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142586264 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-but-1-en-2-yl-3-fluoropiperidine-4-carboxamide |
| SMILES | C=C(CC)NC(=O)C1CCNCC1F |
| InChI | InChI=1S/C10H17FN2O/c1-3-7(2)13-10(14)8-4-5-12-6-9(8)11/h8-9,12H,2-6H2,1H3,(H,13,14) |
| InChIKey | MPERBNJNBUZVHN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |