C24H32ClFN4O4 — CID 142586379
N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7-octahydropyrrolo[1,2-c]pyrimidine-3-carboxamide (PubChem CID 142586379) has the molecular formula C24H32ClFN4O4 and a molecular weight of 495.00 g/mol. Its IUPAC name is N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7-octahydropyrrolo[1,2-c]pyrimidine-3-carboxamide.
| Compound Name | N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7-octahydropyrrolo[1,2-c]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 142586379 |
| Molecular Formula | C24H32ClFN4O4 |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7-octahydropyrrolo[1,2-c]pyrimidine-3-carboxamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC12CCC(NC(=O)C3CC4CCCN4CN3)(CC1)C[C@@H]2O |
| InChI | InChI=1S/C24H32ClFN4O4/c25-17-4-3-16(11-18(17)26)34-13-21(32)28-24-7-5-23(6-8-24,12-20(24)31)29-22(33)19-10-15-2-1-9-30(15)14-27-19/h3-4,11,15,19-20,27,31H,1-2,5-10,12-14H2,(H,28,32)(H,29,33)/t15?,19?,20-,23?,24?/m0/s1 |
| InChIKey | JVLZUZCFMQDWJE-PTIFXUGESA-N |
| XLogP | 1.69 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |