About 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane
2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane (PubChem CID 142586661) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane.
Molecular Properties
| Compound Name | 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane |
| PubChem CID | 142586661 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane |
| SMILES | C=CC1=C(C=C)C(CC(=O)O)N(N)CC1.CC |
| InChI | InChI=1S/C11H16N2O2.C2H6/c1-3-8-5-6-13(12)10(7-11(14)15)9(8)4-2;1-2/h3-4,10H,1-2,5-7,12H2,(H,14,15);1-2H3 |
| InChIKey | PYBQGBXKSNXENA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane?
The IUPAC name of 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane (CID 142586661) is 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane.
What is the SMILES notation for 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane?
The canonical SMILES for 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane is C=CC1=C(C=C)C(CC(=O)O)N(N)CC1.CC.
What is the InChIKey of 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane?
The InChIKey is PYBQGBXKSNXENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2.C2H6/c1-3-8-5-6-13(12)10(7-11(14)15)9(8)4-2;1-2/h3-4,10H,1-2,5-7,12H2,(H,14,15);1-2H3.
What are the key properties of 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane?
2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane has a molecular weight of 238.33 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-amino-4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-6-yl]acetic acid;ethane is sourced from PubChem (CID 142586661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).