About [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol
[3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol (PubChem CID 142586897) has the molecular formula C10H11Cl2N5O
and a molecular weight of 288.14 g/mol. Its IUPAC name is [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol |
| PubChem CID | 142586897 |
| Molecular Formula | C10H11Cl2N5O |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol |
| SMILES | OCC1CCC(n2nnc3c(Cl)nc(Cl)nc32)C1 |
| InChI | InChI=1S/C10H11Cl2N5O/c11-8-7-9(14-10(12)13-8)17(16-15-7)6-2-1-5(3-6)4-18/h5-6,18H,1-4H2 |
| InChIKey | INOAXJXELDGGGA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol?
The IUPAC name of [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol (CID 142586897) is [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol.
What is the SMILES notation for [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol?
The canonical SMILES for [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol is OCC1CCC(n2nnc3c(Cl)nc(Cl)nc32)C1.
What is the InChIKey of [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol?
The InChIKey is INOAXJXELDGGGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2N5O/c11-8-7-9(14-10(12)13-8)17(16-15-7)6-2-1-5(3-6)4-18/h5-6,18H,1-4H2.
What are the key properties of [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol?
[3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol has a molecular weight of 288.14 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5,7-dichlorotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol is sourced from PubChem (CID 142586897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).