C18H29Cl2N4O5P — CID 142586984
4,6-dichloro-1-[5-(2-diethoxyphosphorylethoxymethyl)oxolan-2-yl]pyrazolo[5,4-d]pyrimidine;ethane (PubChem CID 142586984) has the molecular formula C18H29Cl2N4O5P and a molecular weight of 483.33 g/mol. Its IUPAC name is 4,6-dichloro-1-[5-(2-diethoxyphosphorylethoxymethyl)oxolan-2-yl]pyrazolo[5,4-d]pyrimidine;ethane.
| Compound Name | 4,6-dichloro-1-[5-(2-diethoxyphosphorylethoxymethyl)oxolan-2-yl]pyrazolo[5,4-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 142586984 |
| Molecular Formula | C18H29Cl2N4O5P |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4,6-dichloro-1-[5-(2-diethoxyphosphorylethoxymethyl)oxolan-2-yl]pyrazolo[5,4-d]pyrimidine;ethane |
| SMILES | CC.CCOP(=O)(CCOCC1CCC(n2ncc3c(Cl)nc(Cl)nc32)O1)OCC |
| InChI | InChI=1S/C16H23Cl2N4O5P.C2H6/c1-3-25-28(23,26-4-2)8-7-24-10-11-5-6-13(27-11)22-15-12(9-19-22)14(17)20-16(18)21-15;1-2/h9,11,13H,3-8,10H2,1-2H3;1-2H3 |
| InChIKey | AOGUIKUKCHIALD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|