C18H21Cl2N6O7P — CID 142586986
[(2R,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 142586986) has the molecular formula C18H21Cl2N6O7P and a molecular weight of 535.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 142586986 |
| Molecular Formula | C18H21Cl2N6O7P |
| Molecular Weight | 535.28 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methyl-methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | CN(Cc1cccc(Cl)c1)c1nc(Cl)nc2c1nnn2[C@@H]1O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H21Cl2N6O7P/c1-25(6-9-3-2-4-10(19)5-9)15-12-16(22-18(20)21-15)26(24-23-12)17-14(28)13(27)11(33-17)7-32-8-34(29,30)31/h2-5,11,13-14,17,27-28H,6-8H2,1H3,(H2,29,30,31)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | OIOYXCMTHCVMGJ-LSCFUAHRSA-N |
| XLogP | 0.94 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|