C17H19Cl2N6O8PS — CID 142587072
[(2S,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 142587072) has the molecular formula C17H19Cl2N6O8PS and a molecular weight of 569.32 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 142587072 |
| Molecular Formula | C17H19Cl2N6O8PS |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[5-chloro-7-[(3-chlorophenyl)methylamino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2nnc3c(NCc4cccc(Cl)c4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19Cl2N6O8PS/c18-9-3-1-2-8(4-9)5-20-14-11-15(22-17(19)21-14)25(24-23-11)16-13(27)12(26)10(33-16)6-35(31,32)7-34(28,29)30/h1-4,10,12-13,16,26-27H,5-7H2,(H,20,21,22)(H2,28,29,30)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | MFADHEIKRRKWJB-XNIJJKJLSA-N |
| XLogP | 0.31 |
| TPSA | 209.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|