About benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline
benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 142587474) has the molecular formula C23H23Cl2NS
and a molecular weight of 416.42 g/mol. Its IUPAC name is benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 142587474 |
| Molecular Formula | C23H23Cl2NS |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2cc(Cl)cc(Cl)c2C1.c1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12S.C10H11Cl2N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-13-3-2-7-4-8(11)5-10(12)9(7)6-13/h1-10H,11H2;4-5H,2-3,6H2,1H3 |
| InChIKey | IWVMMVGWRMUZOI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline (CID 142587474) is benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline is CN1CCc2cc(Cl)cc(Cl)c2C1.c1ccc(CSc2ccccc2)cc1.
What is the InChIKey of benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is IWVMMVGWRMUZOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12S.C10H11Cl2N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-13-3-2-7-4-8(11)5-10(12)9(7)6-13/h1-10H,11H2;4-5H,2-3,6H2,1H3.
What are the key properties of benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline?
benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 416.42 g/mol, XLogP of 6.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanylbenzene;6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 142587474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).