About 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea
1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea (PubChem CID 142587922) has the molecular formula C19H27FN4O3S
and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea.
Molecular Properties
| Compound Name | 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea |
| PubChem CID | 142587922 |
| Molecular Formula | C19H27FN4O3S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea |
| SMILES | CC(O)Cn1ccc(S(=O)NC(=O)Nc2c(C(C)C)cc(F)cc2C(C)C)n1 |
| InChI | InChI=1S/C19H27FN4O3S/c1-11(2)15-8-14(20)9-16(12(3)4)18(15)21-19(26)23-28(27)17-6-7-24(22-17)10-13(5)25/h6-9,11-13,25H,10H2,1-5H3,(H2,21,23,26) |
| InChIKey | AIHHFHKDVOVATI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea?
The IUPAC name of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea (CID 142587922) is 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea.
What is the SMILES notation for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea?
The canonical SMILES for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea is CC(O)Cn1ccc(S(=O)NC(=O)Nc2c(C(C)C)cc(F)cc2C(C)C)n1.
What is the InChIKey of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea?
The InChIKey is AIHHFHKDVOVATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN4O3S/c1-11(2)15-8-14(20)9-16(12(3)4)18(15)21-19(26)23-28(27)17-6-7-24(22-17)10-13(5)25/h6-9,11-13,25H,10H2,1-5H3,(H2,21,23,26).
What are the key properties of 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea?
1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea has a molecular weight of 410.52 g/mol, XLogP of 3.49, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-[1-(2-hydroxypropyl)pyrazol-3-yl]sulfinylurea is sourced from PubChem (CID 142587922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).