C7H10FN3O3S — CID 142588038
5-(3-fluorooxetan-3-yl)-1-methylpyrazole-3-sulfonamide (PubChem CID 142588038) has the molecular formula C7H10FN3O3S and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(3-fluorooxetan-3-yl)-1-methylpyrazole-3-sulfonamide.
| Compound Name | 5-(3-fluorooxetan-3-yl)-1-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 142588038 |
| Molecular Formula | C7H10FN3O3S |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 5-(3-fluorooxetan-3-yl)-1-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nc(S(N)(=O)=O)cc1C1(F)COC1 |
| InChI | InChI=1S/C7H10FN3O3S/c1-11-5(7(8)3-14-4-7)2-6(10-11)15(9,12)13/h2H,3-4H2,1H3,(H2,9,12,13) |
| InChIKey | QOGJCLLKYHXTTE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |