C9H14N4O — CID 142588322
[(1R,3S)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]methanol (PubChem CID 142588322) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is [(1R,3S)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 142588322 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [(1R,3S)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]methanol |
| SMILES | OC[C@@H]1CC[C@H](Nc2ncncn2)C1 |
| InChI | InChI=1S/C9H14N4O/c14-4-7-1-2-8(3-7)13-9-11-5-10-6-12-9/h5-8,14H,1-4H2,(H,10,11,12,13)/t7-,8+/m1/s1 |
| InChIKey | XMLBDLHJABAOFW-SFYZADRCSA-N |
| XLogP | 0.44 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |