About 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid
4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid (PubChem CID 142588346) has the molecular formula C10H18N3O4P
and a molecular weight of 275.24 g/mol. Its IUPAC name is 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid.
Molecular Properties
| Compound Name | 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid |
| PubChem CID | 142588346 |
| Molecular Formula | C10H18N3O4P |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid |
| SMILES | O=c1cc(NC2CCC(CO)C2)nc[nH]1.OPO |
| InChI | InChI=1S/C10H15N3O2.H3O2P/c14-5-7-1-2-8(3-7)13-9-4-10(15)12-6-11-9;1-3-2/h4,6-8,14H,1-3,5H2,(H2,11,12,13,15);1-3H |
| InChIKey | XIBOEMKSVSAONS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid?
The IUPAC name of 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid (CID 142588346) is 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid.
What is the SMILES notation for 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid?
The canonical SMILES for 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid is O=c1cc(NC2CCC(CO)C2)nc[nH]1.OPO.
What is the InChIKey of 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid?
The InChIKey is XIBOEMKSVSAONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2.H3O2P/c14-5-7-1-2-8(3-7)13-9-4-10(15)12-6-11-9;1-3-2/h4,6-8,14H,1-3,5H2,(H2,11,12,13,15);1-3H.
What are the key properties of 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid?
4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid has a molecular weight of 275.24 g/mol, XLogP of -0.18, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(hydroxymethyl)cyclopentyl]amino]-1H-pyrimidin-6-one;phosphonous acid is sourced from PubChem (CID 142588346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).