C28H45FN2O4Si — CID 142588520
tert-butyl N-[(2S,5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(5-fluoro-2-methylphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrrolizin-2-yl]carbamate (PubChem CID 142588520) has the molecular formula C28H45FN2O4Si and a molecular weight of 520.76 g/mol. Its IUPAC name is tert-butyl N-[(2S,5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(5-fluoro-2-methylphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrrolizin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(5-fluoro-2-methylphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrrolizin-2-yl]carbamate |
|---|---|
| PubChem CID | 142588520 |
| Molecular Formula | C28H45FN2O4Si |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | tert-butyl N-[(2S,5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(5-fluoro-2-methylphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrrolizin-2-yl]carbamate |
| SMILES | Cc1ccc(F)cc1[C@]12CC[C@H](C(C)(C)O[Si](C)(C)C(C)(C)C)N1C(=O)[C@@H](NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C28H45FN2O4Si/c1-18-12-13-19(29)16-20(18)28-15-14-22(27(8,9)35-36(10,11)26(5,6)7)31(28)23(32)21(17-28)30-24(33)34-25(2,3)4/h12-13,16,21-22H,14-15,17H2,1-11H3,(H,30,33)/t21-,22+,28+/m0/s1 |
| InChIKey | DOUNKOMRUMIKGF-PFPZSTESSA-N |
| XLogP | 6.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|