C22H32ClF2NO2Si — CID 142588589
(5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(2-chloro-4,5-difluorophenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 142588589) has the molecular formula C22H32ClF2NO2Si and a molecular weight of 444.04 g/mol. Its IUPAC name is (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(2-chloro-4,5-difluorophenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(2-chloro-4,5-difluorophenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 142588589 |
| Molecular Formula | C22H32ClF2NO2Si |
| Molecular Weight | 444.04 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(2-chloro-4,5-difluorophenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@]2(c3cc(F)c(F)cc3Cl)CCC(=O)N12 |
| InChI | InChI=1S/C22H32ClF2NO2Si/c1-20(2,3)29(6,7)28-21(4,5)18-8-10-22(11-9-19(27)26(18)22)14-12-16(24)17(25)13-15(14)23/h12-13,18H,8-11H2,1-7H3/t18-,22-/m1/s1 |
| InChIKey | ZVEBIVAOYOGETP-XMSQKQJNSA-N |
| XLogP | 6.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.04 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|