C23H35F2NO2Si — CID 142588632
(5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(4,5-difluoro-2-methylphenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 142588632) has the molecular formula C23H35F2NO2Si and a molecular weight of 423.62 g/mol. Its IUPAC name is (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(4,5-difluoro-2-methylphenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(4,5-difluoro-2-methylphenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 142588632 |
| Molecular Formula | C23H35F2NO2Si |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (5R,8R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-8-(4,5-difluoro-2-methylphenyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | Cc1cc(F)c(F)cc1[C@@]12CCC(=O)N1[C@@H](C(C)(C)O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C23H35F2NO2Si/c1-15-13-17(24)18(25)14-16(15)23-11-9-19(26(23)20(27)10-12-23)22(5,6)28-29(7,8)21(2,3)4/h13-14,19H,9-12H2,1-8H3/t19-,23-/m1/s1 |
| InChIKey | CTTPEIAKYIRUPJ-AUSIDOKSSA-N |
| XLogP | 6.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|