About (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide
(2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide (PubChem CID 142589359) has the molecular formula C17H16Cl2N2O2SSe
and a molecular weight of 462.26 g/mol. Its IUPAC name is (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide.
Molecular Properties
| Compound Name | (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
| PubChem CID | 142589359 |
| Molecular Formula | C17H16Cl2N2O2SSe |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide |
| SMILES | O=C(NCC[Se]Sc1ccccc1)/C(Cc1ccc(Cl)c(Cl)c1)=N/O |
| InChI | InChI=1S/C17H16Cl2N2O2SSe/c18-14-7-6-12(10-15(14)19)11-16(21-23)17(22)20-8-9-25-24-13-4-2-1-3-5-13/h1-7,10,23H,8-9,11H2,(H,20,22)/b21-16+ |
| InChIKey | HAPTYYNUMKUTJT-LTGZKZEYSA-N |
| XLogP | 4.31 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide?
The IUPAC name of (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide (CID 142589359) is (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide.
What is the SMILES notation for (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide?
The canonical SMILES for (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide is O=C(NCC[Se]Sc1ccccc1)/C(Cc1ccc(Cl)c(Cl)c1)=N/O.
What is the InChIKey of (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide?
The InChIKey is HAPTYYNUMKUTJT-LTGZKZEYSA-N. The full InChI is InChI=1S/C17H16Cl2N2O2SSe/c18-14-7-6-12(10-15(14)19)11-16(21-23)17(22)20-8-9-25-24-13-4-2-1-3-5-13/h1-7,10,23H,8-9,11H2,(H,20,22)/b21-16+.
What are the key properties of (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide?
(2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide has a molecular weight of 462.26 g/mol, XLogP of 4.31, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-(3,4-dichlorophenyl)-2-hydroxyimino-N-(2-phenylsulfanylselanylethyl)propanamide is sourced from PubChem (CID 142589359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).