C20H21FN6O — CID 142589431
(6R,14R)-9-fluoro-13,14-dimethyl-2,11,15,19,20,23-hexazapentacyclo[15.5.2.02,6.07,12.020,24]tetracosa-1(23),7(12),8,10,17(24),18,21-heptaen-16-one (PubChem CID 142589431) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is (6R,14R)-9-fluoro-13,14-dimethyl-2,11,15,19,20,23-hexazapentacyclo[15.5.2.02,6.07,12.020,24]tetracosa-1(23),7(12),8,10,17(24),18,21-heptaen-16-one.
| Compound Name | (6R,14R)-9-fluoro-13,14-dimethyl-2,11,15,19,20,23-hexazapentacyclo[15.5.2.02,6.07,12.020,24]tetracosa-1(23),7(12),8,10,17(24),18,21-heptaen-16-one |
|---|---|
| PubChem CID | 142589431 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (6R,14R)-9-fluoro-13,14-dimethyl-2,11,15,19,20,23-hexazapentacyclo[15.5.2.02,6.07,12.020,24]tetracosa-1(23),7(12),8,10,17(24),18,21-heptaen-16-one |
| SMILES | CC1c2ncc(F)cc2[C@H]2CCCN2c2ccn3ncc(c3n2)C(=O)N[C@@H]1C |
| InChI | InChI=1S/C20H21FN6O/c1-11-12(2)24-20(28)15-10-23-27-7-5-17(25-19(15)27)26-6-3-4-16(26)14-8-13(21)9-22-18(11)14/h5,7-12,16H,3-4,6H2,1-2H3,(H,24,28)/t11?,12-,16-/m1/s1 |
| InChIKey | NWSVFOOWLYKCTQ-ZLXOECBPSA-N |
| XLogP | 2.84 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|