C20H19FN6O2 — CID 142589451
(4S,6R,7R,13S)-10-fluoro-13-methyl-2,12,15,19,20,23-hexazahexacyclo[15.5.2.18,12.02,7.04,6.020,24]pentacosa-1(23),8,10,17(24),18,21-hexaene-16,25-dione (PubChem CID 142589451) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is (4S,6R,7R,13S)-10-fluoro-13-methyl-2,12,15,19,20,23-hexazahexacyclo[15.5.2.18,12.02,7.04,6.020,24]pentacosa-1(23),8,10,17(24),18,21-hexaene-16,25-dione.
| Compound Name | (4S,6R,7R,13S)-10-fluoro-13-methyl-2,12,15,19,20,23-hexazahexacyclo[15.5.2.18,12.02,7.04,6.020,24]pentacosa-1(23),8,10,17(24),18,21-hexaene-16,25-dione |
|---|---|
| PubChem CID | 142589451 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4S,6R,7R,13S)-10-fluoro-13-methyl-2,12,15,19,20,23-hexazahexacyclo[15.5.2.18,12.02,7.04,6.020,24]pentacosa-1(23),8,10,17(24),18,21-hexaene-16,25-dione |
| SMILES | C[C@H]1CNC(=O)c2cnn3ccc(nc23)N2C[C@H]3C[C@H]3[C@@H]2c2cc(F)cn1c2=O |
| InChI | InChI=1S/C20H19FN6O2/c1-10-6-22-19(28)15-7-23-27-3-2-16(24-18(15)27)26-8-11-4-13(11)17(26)14-5-12(21)9-25(10)20(14)29/h2-3,5,7,9-11,13,17H,4,6,8H2,1H3,(H,22,28)/t10-,11+,13+,17+/m0/s1 |
| InChIKey | ZPEJZZOZJPSPQI-RWYOIZDWSA-N |
| XLogP | 1.53 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |