C20H23FN6O2 — CID 142589500
(6R)-9-fluoro-4,14-dimethyl-13-oxa-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),22-hexaen-17-one (PubChem CID 142589500) has the molecular formula C20H23FN6O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is (6R)-9-fluoro-4,14-dimethyl-13-oxa-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),22-hexaen-17-one.
| Compound Name | (6R)-9-fluoro-4,14-dimethyl-13-oxa-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),22-hexaen-17-one |
|---|---|
| PubChem CID | 142589500 |
| Molecular Formula | C20H23FN6O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (6R)-9-fluoro-4,14-dimethyl-13-oxa-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),22-hexaen-17-one |
| SMILES | CC1C[C@@H]2c3cc(F)cnc3OC(C)CNC(=O)C3=C4N=C(C=CN4NC3)N2C1 |
| InChI | InChI=1S/C20H23FN6O2/c1-11-5-16-14-6-13(21)8-23-20(14)29-12(2)7-22-19(28)15-9-24-27-4-3-17(25-18(15)27)26(16)10-11/h3-4,6,8,11-12,16,24H,5,7,9-10H2,1-2H3,(H,22,28)/t11?,12?,16-/m1/s1 |
| InChIKey | UUQHHCULVVMECI-ZEPSKSRBSA-N |
| XLogP | 1.46 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |