C19H21N7O — CID 142589519
(6R)-15-methyl-2,9,11,16,20,24,25-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7,9,11,18,20,22-heptaen-17-one (PubChem CID 142589519) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is (6R)-15-methyl-2,9,11,16,20,24,25-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7,9,11,18,20,22-heptaen-17-one.
| Compound Name | (6R)-15-methyl-2,9,11,16,20,24,25-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7,9,11,18,20,22-heptaen-17-one |
|---|---|
| PubChem CID | 142589519 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (6R)-15-methyl-2,9,11,16,20,24,25-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7,9,11,18,20,22-heptaen-17-one |
| SMILES | CC1CCc2ncncc2[C@H]2CCCN2c2ccc3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C19H21N7O/c1-12-4-5-14-13(9-20-11-22-14)15-3-2-8-25(15)18-7-6-17-21-10-16(19(27)23-12)26(17)24-18/h6-7,9-12,15H,2-5,8H2,1H3,(H,23,27)/t12?,15-/m1/s1 |
| InChIKey | VMAUCUBWJOQIGK-WPZCJLIBSA-N |
| XLogP | 1.93 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |