C27H29FN4O4 — CID 142589767
ethyl (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[1-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3,4-dihydropyrrolo[1,2-a]pyrazin-2-yl]propanoate (PubChem CID 142589767) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is ethyl (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[1-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3,4-dihydropyrrolo[1,2-a]pyrazin-2-yl]propanoate.
| Compound Name | ethyl (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[1-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3,4-dihydropyrrolo[1,2-a]pyrazin-2-yl]propanoate |
|---|---|
| PubChem CID | 142589767 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | ethyl (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[1-oxo-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3,4-dihydropyrrolo[1,2-a]pyrazin-2-yl]propanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccc(OC)c(F)c1)N1CCn2cc(-c3ccc4c(n3)NCCC4)cc2C1=O |
| InChI | InChI=1S/C27H29FN4O4/c1-3-36-25(33)15-22(18-7-9-24(35-2)20(28)13-18)32-12-11-31-16-19(14-23(31)27(32)34)21-8-6-17-5-4-10-29-26(17)30-21/h6-9,13-14,16,22H,3-5,10-12,15H2,1-2H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | YIFCOJFLUWRQRX-QFIPXVFZSA-N |
| XLogP | 4.21 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |