C28H26F8N2O3 — CID 142589881
(2,3,4,5,6-pentafluorophenyl) 1-[(1R)-1-[4-[3-(difluoromethoxy)azetidin-1-yl]cyclohexyl]ethyl]-6-fluoro-2-methylindole-3-carboxylate (PubChem CID 142589881) has the molecular formula C28H26F8N2O3 and a molecular weight of 590.51 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[(1R)-1-[4-[3-(difluoromethoxy)azetidin-1-yl]cyclohexyl]ethyl]-6-fluoro-2-methylindole-3-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[(1R)-1-[4-[3-(difluoromethoxy)azetidin-1-yl]cyclohexyl]ethyl]-6-fluoro-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 142589881 |
| Molecular Formula | C28H26F8N2O3 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[(1R)-1-[4-[3-(difluoromethoxy)azetidin-1-yl]cyclohexyl]ethyl]-6-fluoro-2-methylindole-3-carboxylate |
| SMILES | Cc1c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c2ccc(F)cc2n1[C@H](C)C1CCC(N2CC(OC(F)F)C2)CC1 |
| InChI | InChI=1S/C28H26F8N2O3/c1-12(14-3-6-16(7-4-14)37-10-17(11-37)40-28(35)36)38-13(2)20(18-8-5-15(29)9-19(18)38)27(39)41-26-24(33)22(31)21(30)23(32)25(26)34/h5,8-9,12,14,16-17,28H,3-4,6-7,10-11H2,1-2H3/t12-,14?,16?/m1/s1 |
| InChIKey | UJWKGDIEFKBISB-XEBKBJJBSA-N |
| XLogP | 7.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|