C23H32O3 — CID 14259037
(3aR,7aR)-3a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,7a-dihydro-3H-1-benzofuran-2,5-dione (PubChem CID 14259037) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3aR,7aR)-3a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,7a-dihydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3aR,7aR)-3a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,7a-dihydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 14259037 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (3aR,7aR)-3a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,7a-dihydro-3H-1-benzofuran-2,5-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C[C@]12CC(=O)C=C[C@H]1OC(=O)C2 |
| InChI | InChI=1S/C23H32O3/c1-17(2)7-5-8-18(3)9-6-10-19(4)13-14-23-15-20(24)11-12-21(23)26-22(25)16-23/h7,9,11-13,21H,5-6,8,10,14-16H2,1-4H3/b18-9+,19-13+/t21-,23-/m1/s1 |
| InChIKey | MXERJWHSUSUHEB-ZANLQHRNSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|