C21H17ClFN5OS — CID 142590388
N-(2-chlorophenyl)sulfanyl-5-(8-ethyl-2-fluoroquinazolin-6-yl)-6-methoxypyrazin-2-amine (PubChem CID 142590388) has the molecular formula C21H17ClFN5OS and a molecular weight of 441.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)sulfanyl-5-(8-ethyl-2-fluoroquinazolin-6-yl)-6-methoxypyrazin-2-amine.
| Compound Name | N-(2-chlorophenyl)sulfanyl-5-(8-ethyl-2-fluoroquinazolin-6-yl)-6-methoxypyrazin-2-amine |
|---|---|
| PubChem CID | 142590388 |
| Molecular Formula | C21H17ClFN5OS |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-(2-chlorophenyl)sulfanyl-5-(8-ethyl-2-fluoroquinazolin-6-yl)-6-methoxypyrazin-2-amine |
| SMILES | CCc1cc(-c2ncc(NSc3ccccc3Cl)nc2OC)cc2cnc(F)nc12 |
| InChI | InChI=1S/C21H17ClFN5OS/c1-3-12-8-13(9-14-10-25-21(23)27-18(12)14)19-20(29-2)26-17(11-24-19)28-30-16-7-5-4-6-15(16)22/h4-11H,3H2,1-2H3,(H,26,28) |
| InChIKey | UYZLAQKILLFVOG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|