C24H36O4 — CID 14259039
(4R,4aR,7aR)-4-methoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione (PubChem CID 14259039) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (4R,4aR,7aR)-4-methoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione.
| Compound Name | (4R,4aR,7aR)-4-methoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione |
|---|---|
| PubChem CID | 14259039 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4R,4aR,7aR)-4-methoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione |
| SMILES | CO[C@@H]1CC(=O)O[C@@H]2CC(=O)C[C@]12C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H36O4/c1-17(2)8-6-9-18(3)10-7-11-19(4)12-13-24-16-20(25)14-22(24)28-23(26)15-21(24)27-5/h8,10,12,21-22H,6-7,9,11,13-16H2,1-5H3/b18-10+,19-12+/t21-,22-,24-/m1/s1 |
| InChIKey | OZCWUZPIDKADGT-MNAZALABSA-N |
| XLogP | 5.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|