C25H38O4 — CID 14259041
(4R,4aR,7aR)-4-ethoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione (PubChem CID 14259041) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (4R,4aR,7aR)-4-ethoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione.
| Compound Name | (4R,4aR,7aR)-4-ethoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione |
|---|---|
| PubChem CID | 14259041 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (4R,4aR,7aR)-4-ethoxy-4a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-4,5,7,7a-tetrahydro-3H-cyclopenta[b]pyran-2,6-dione |
| SMILES | CCO[C@@H]1CC(=O)O[C@@H]2CC(=O)C[C@]12C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H38O4/c1-6-28-22-16-24(27)29-23-15-21(26)17-25(22,23)14-13-20(5)12-8-11-19(4)10-7-9-18(2)3/h9,11,13,22-23H,6-8,10,12,14-17H2,1-5H3/b19-11+,20-13+/t22-,23-,25-/m1/s1 |
| InChIKey | BOVUSYWJRLVHHQ-VHVPNAOWSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|