C21H31BrN4O2 — CID 142590418
tert-butyl N-[6-[(6-bromo-8-ethylquinazolin-2-yl)amino]hexan-3-yl]carbamate (PubChem CID 142590418) has the molecular formula C21H31BrN4O2 and a molecular weight of 451.41 g/mol. Its IUPAC name is tert-butyl N-[6-[(6-bromo-8-ethylquinazolin-2-yl)amino]hexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-[(6-bromo-8-ethylquinazolin-2-yl)amino]hexan-3-yl]carbamate |
|---|---|
| PubChem CID | 142590418 |
| Molecular Formula | C21H31BrN4O2 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | tert-butyl N-[6-[(6-bromo-8-ethylquinazolin-2-yl)amino]hexan-3-yl]carbamate |
| SMILES | CCc1cc(Br)cc2cnc(NCCCC(CC)NC(=O)OC(C)(C)C)nc12 |
| InChI | InChI=1S/C21H31BrN4O2/c1-6-14-11-16(22)12-15-13-24-19(26-18(14)15)23-10-8-9-17(7-2)25-20(27)28-21(3,4)5/h11-13,17H,6-10H2,1-5H3,(H,25,27)(H,23,24,26) |
| InChIKey | KPSLPSHEIIPSDU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|