C28H33ClFN5S — CID 142590423
4-[3-[(Z)-aminomethyliminomethyl]-5-ethyl-4-(methylideneamino)phenyl]-N-(2-chlorophenyl)sulfanyl-2-fluoroaniline;cyclopentanamine (PubChem CID 142590423) has the molecular formula C28H33ClFN5S and a molecular weight of 526.13 g/mol. Its IUPAC name is 4-[3-[(Z)-aminomethyliminomethyl]-5-ethyl-4-(methylideneamino)phenyl]-N-(2-chlorophenyl)sulfanyl-2-fluoroaniline;cyclopentanamine.
| Compound Name | 4-[3-[(Z)-aminomethyliminomethyl]-5-ethyl-4-(methylideneamino)phenyl]-N-(2-chlorophenyl)sulfanyl-2-fluoroaniline;cyclopentanamine |
|---|---|
| PubChem CID | 142590423 |
| Molecular Formula | C28H33ClFN5S |
| Molecular Weight | 526.13 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 4-[3-[(Z)-aminomethyliminomethyl]-5-ethyl-4-(methylideneamino)phenyl]-N-(2-chlorophenyl)sulfanyl-2-fluoroaniline;cyclopentanamine |
| SMILES | C=Nc1c(/C=N\CN)cc(-c2ccc(NSc3ccccc3Cl)c(F)c2)cc1CC.NC1CCCC1 |
| InChI | InChI=1S/C23H22ClFN4S.C5H11N/c1-3-15-10-17(11-18(13-28-14-26)23(15)27-2)16-8-9-21(20(25)12-16)29-30-22-7-5-4-6-19(22)24;6-5-3-1-2-4-5/h4-13,29H,2-3,14,26H2,1H3;5H,1-4,6H2/b28-13-; |
| InChIKey | MLWXFFJZDDNCBT-USRVYZHRSA-N |
| XLogP | 7.38 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.13 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|