About (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol
(4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol (PubChem CID 142590707) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol.
Molecular Properties
| Compound Name | (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol |
| PubChem CID | 142590707 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol |
| SMILES | C=C/C=C(\C=C)CC(O)CN1CCC(N)CC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-5-12(4-2)10-14(17)11-16-8-6-13(15)7-9-16/h3-5,13-14,17H,1-2,6-11,15H2/b12-5+ |
| InChIKey | RMNOCPXQLAWDQB-LFYBBSHMSA-N |
| XLogP | 1.46 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol?
The IUPAC name of (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol (CID 142590707) is (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol.
What is the SMILES notation for (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol?
The canonical SMILES for (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol is C=C/C=C(\C=C)CC(O)CN1CCC(N)CC1.
What is the InChIKey of (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol?
The InChIKey is RMNOCPXQLAWDQB-LFYBBSHMSA-N. The full InChI is InChI=1S/C14H24N2O/c1-3-5-12(4-2)10-14(17)11-16-8-6-13(15)7-9-16/h3-5,13-14,17H,1-2,6-11,15H2/b12-5+.
What are the key properties of (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol?
(4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol has a molecular weight of 236.36 g/mol, XLogP of 1.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1-(4-aminopiperidin-1-yl)-4-ethenylhepta-4,6-dien-2-ol is sourced from PubChem (CID 142590707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).