C25H32F2N2OS — CID 142590728
1-[4-[2-[bis(4-fluorophenyl)methylsulfanyl]ethylamino]piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 142590728) has the molecular formula C25H32F2N2OS and a molecular weight of 446.61 g/mol. Its IUPAC name is 1-[4-[2-[bis(4-fluorophenyl)methylsulfanyl]ethylamino]piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[2-[bis(4-fluorophenyl)methylsulfanyl]ethylamino]piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 142590728 |
| Molecular Formula | C25H32F2N2OS |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-[4-[2-[bis(4-fluorophenyl)methylsulfanyl]ethylamino]piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC(NCCSC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H32F2N2OS/c1-25(2,3)24(30)29-15-12-22(13-16-29)28-14-17-31-23(18-4-8-20(26)9-5-18)19-6-10-21(27)11-7-19/h4-11,22-23,28H,12-17H2,1-3H3 |
| InChIKey | JJISSBKYYCWHFH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|