About (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine
(3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine (PubChem CID 142590736) has the molecular formula C21H26F2N2S
and a molecular weight of 376.52 g/mol. Its IUPAC name is (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine |
| PubChem CID | 142590736 |
| Molecular Formula | C21H26F2N2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(CCSC(c2ccc(F)cc2)c2ccc(F)cc2)C[C@H](C)N1 |
| InChI | InChI=1S/C21H26F2N2S/c1-15-13-25(14-16(2)24-15)11-12-26-21(17-3-7-19(22)8-4-17)18-5-9-20(23)10-6-18/h3-10,15-16,21,24H,11-14H2,1-2H3/t15-,16+ |
| InChIKey | VWCPEARXGTWKHO-IYBDPMFKSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine?
The IUPAC name of (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine (CID 142590736) is (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine.
What is the SMILES notation for (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine?
The canonical SMILES for (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine is C[C@@H]1CN(CCSC(c2ccc(F)cc2)c2ccc(F)cc2)C[C@H](C)N1.
What is the InChIKey of (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine?
The InChIKey is VWCPEARXGTWKHO-IYBDPMFKSA-N. The full InChI is InChI=1S/C21H26F2N2S/c1-15-13-25(14-16(2)24-15)11-12-26-21(17-3-7-19(22)8-4-17)18-5-9-20(23)10-6-18/h3-10,15-16,21,24H,11-14H2,1-2H3/t15-,16+.
What are the key properties of (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine?
(3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine has a molecular weight of 376.52 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-3,5-dimethylpiperazine is sourced from PubChem (CID 142590736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).