C28H29F5N2S — CID 142590753
N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 142590753) has the molecular formula C28H29F5N2S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142590753 |
| Molecular Formula | C28H29F5N2S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | Fc1ccc(C(SCCNC2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H29F5N2S/c29-24-9-3-21(4-10-24)27(22-5-11-25(30)12-6-22)36-18-15-34-26-13-16-35(17-14-26)19-20-1-7-23(8-2-20)28(31,32)33/h1-12,26-27,34H,13-19H2 |
| InChIKey | SDISULJMGRDCFH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|