C12H17NO — CID 142590994
5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpyrrolidin-2-one (PubChem CID 142590994) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpyrrolidin-2-one.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 142590994 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpyrrolidin-2-one |
| SMILES | C=C/C(=C\C=C/C)C1CCC(=O)N1C |
| InChI | InChI=1S/C12H17NO/c1-4-6-7-10(5-2)11-8-9-12(14)13(11)3/h4-7,11H,2,8-9H2,1,3H3/b6-4-,10-7+ |
| InChIKey | LIQZYPJHJPJXTH-BSAFSDHNSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|