C34H36ClFN4O3 — CID 142591250
19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591250) has the molecular formula C34H36ClFN4O3 and a molecular weight of 603.14 g/mol. Its IUPAC name is 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591250 |
| Molecular Formula | C34H36ClFN4O3 |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 19-chloro-3-ethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1c2c(nn1C)CN(C)CCCCn1c(C(=O)O)c(CCCOc3cccc4cc(F)ccc34)c3ccc(Cl)c-2c31 |
| InChI | InChI=1S/C34H36ClFN4O3/c1-4-28-31-27(37-39(28)3)20-38(2)16-5-6-17-40-32-25(14-15-26(35)30(31)32)24(33(40)34(41)42)10-8-18-43-29-11-7-9-21-19-22(36)12-13-23(21)29/h7,9,11-15,19H,4-6,8,10,16-18,20H2,1-3H3,(H,41,42) |
| InChIKey | BPPSKYUYBHETDL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|