C34H34ClF3N4O3 — CID 142591333
19-chloro-3-ethyl-10,10-difluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591333) has the molecular formula C34H34ClF3N4O3 and a molecular weight of 639.12 g/mol. Its IUPAC name is 19-chloro-3-ethyl-10,10-difluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 19-chloro-3-ethyl-10,10-difluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591333 |
| Molecular Formula | C34H34ClF3N4O3 |
| Molecular Weight | 639.12 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 19-chloro-3-ethyl-10,10-difluoro-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4,8-dimethyl-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1c2c(nn1C)CN(C)CC(F)(F)CCn1c(C(=O)O)c(CCCOc3cccc4cc(F)ccc34)c3ccc(Cl)c-2c31 |
| InChI | InChI=1S/C34H34ClF3N4O3/c1-4-27-30-26(39-41(27)3)18-40(2)19-34(37,38)14-15-42-31-24(12-13-25(35)29(30)31)23(32(42)33(43)44)8-6-16-45-28-9-5-7-20-17-21(36)10-11-22(20)28/h5,7,9-13,17H,4,6,8,14-16,18-19H2,1-3H3,(H,43,44) |
| InChIKey | YZYMZHBSKWEGRE-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.12 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|