C34H36ClFN4O5S — CID 142591636
19-chloro-3,8-diethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid (PubChem CID 142591636) has the molecular formula C34H36ClFN4O5S and a molecular weight of 667.20 g/mol. Its IUPAC name is 19-chloro-3,8-diethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid.
| Compound Name | 19-chloro-3,8-diethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 142591636 |
| Molecular Formula | C34H36ClFN4O5S |
| Molecular Weight | 667.20 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 19-chloro-3,8-diethyl-15-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-4-methyl-9,9-dioxo-9λ6-thia-4,5,8,13-tetrazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylic acid |
| SMILES | CCc1c2c(nn1C)CN(CC)S(=O)(=O)CCCn1c(C(=O)O)c(CCCOc3cccc4cc(F)ccc34)c3ccc(Cl)c-2c31 |
| InChI | InChI=1S/C34H36ClFN4O5S/c1-4-28-31-27(37-38(28)3)20-39(5-2)46(43,44)18-8-16-40-32-25(14-15-26(35)30(31)32)24(33(40)34(41)42)10-7-17-45-29-11-6-9-21-19-22(36)12-13-23(21)29/h6,9,11-15,19H,4-5,7-8,10,16-18,20H2,1-3H3,(H,41,42) |
| InChIKey | VJZQVIHVPSHCPC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.20 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|