About 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine
1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine (PubChem CID 142591714) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine |
| PubChem CID | 142591714 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine |
| SMILES | C=C/C(=C\C)N1CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C11H20N2O2S/c1-4-11(5-2)12-7-9-13(10-8-12)16(14,15)6-3/h4-5H,1,6-10H2,2-3H3/b11-5+ |
| InChIKey | AVPFLCCVOZANAX-VZUCSPMQSA-N |
| XLogP | 1.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine?
The IUPAC name of 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine (CID 142591714) is 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine.
What is the SMILES notation for 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine?
The canonical SMILES for 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine is C=C/C(=C\C)N1CCN(S(=O)(=O)CC)CC1.
What is the InChIKey of 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine?
The InChIKey is AVPFLCCVOZANAX-VZUCSPMQSA-N. The full InChI is InChI=1S/C11H20N2O2S/c1-4-11(5-2)12-7-9-13(10-8-12)16(14,15)6-3/h4-5H,1,6-10H2,2-3H3/b11-5+.
What are the key properties of 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine?
1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine has a molecular weight of 244.36 g/mol, XLogP of 1.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-4-[(3E)-penta-1,3-dien-3-yl]piperazine is sourced from PubChem (CID 142591714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).