C22H27NO — CID 142592034
(3E,5E)-3-(cyclohexa-1,5-dien-1-ylmethylidene)-5-[(2E)-2-ethenylpenta-2,4-dienylidene]-1-propan-2-ylpiperidin-4-one (PubChem CID 142592034) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (3E,5E)-3-(cyclohexa-1,5-dien-1-ylmethylidene)-5-[(2E)-2-ethenylpenta-2,4-dienylidene]-1-propan-2-ylpiperidin-4-one.
| Compound Name | (3E,5E)-3-(cyclohexa-1,5-dien-1-ylmethylidene)-5-[(2E)-2-ethenylpenta-2,4-dienylidene]-1-propan-2-ylpiperidin-4-one |
|---|---|
| PubChem CID | 142592034 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3E,5E)-3-(cyclohexa-1,5-dien-1-ylmethylidene)-5-[(2E)-2-ethenylpenta-2,4-dienylidene]-1-propan-2-ylpiperidin-4-one |
| SMILES | C=C/C=C(C=C)/C=C1\CN(C(C)C)C/C(=C\C2=CCCC=C2)C1=O |
| InChI | InChI=1S/C22H27NO/c1-5-10-18(6-2)13-20-15-23(17(3)4)16-21(22(20)24)14-19-11-8-7-9-12-19/h5-6,8,10-14,17H,1-2,7,9,15-16H2,3-4H3/b18-10+,20-13+,21-14+ |
| InChIKey | NJJKXEWSJPODIS-ZXJYVQJRSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|