About (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole
(6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole (PubChem CID 142592470) has the molecular formula C13H11ClFIN2O
and a molecular weight of 392.60 g/mol. Its IUPAC name is (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole.
Molecular Properties
| Compound Name | (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole |
| PubChem CID | 142592470 |
| Molecular Formula | C13H11ClFIN2O |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole |
| SMILES | C[C@H]1Cc2c(c(I)nn2-c2ccc(F)c(Cl)c2)CO1 |
| InChI | InChI=1S/C13H11ClFIN2O/c1-7-4-12-9(6-19-7)13(16)17-18(12)8-2-3-11(15)10(14)5-8/h2-3,5,7H,4,6H2,1H3/t7-/m0/s1 |
| InChIKey | KASPEEFZDAZDJG-ZETCQYMHSA-N |
| XLogP | 3.73 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole?
The IUPAC name of (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole (CID 142592470) is (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole.
What is the SMILES notation for (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole?
The canonical SMILES for (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole is C[C@H]1Cc2c(c(I)nn2-c2ccc(F)c(Cl)c2)CO1.
What is the InChIKey of (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole?
The InChIKey is KASPEEFZDAZDJG-ZETCQYMHSA-N. The full InChI is InChI=1S/C13H11ClFIN2O/c1-7-4-12-9(6-19-7)13(16)17-18(12)8-2-3-11(15)10(14)5-8/h2-3,5,7H,4,6H2,1H3/t7-/m0/s1.
What are the key properties of (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole?
(6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole has a molecular weight of 392.60 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-(3-chloro-4-fluorophenyl)-3-iodo-6-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole is sourced from PubChem (CID 142592470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).