About N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide
N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 142592630) has the molecular formula C22H20F3N3O5
and a molecular weight of 463.41 g/mol. Its IUPAC name is N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide |
| PubChem CID | 142592630 |
| Molecular Formula | C22H20F3N3O5 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc(C(F)(F)F)nc2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H20F3N3O5/c1-30-15-7-5-12(9-17(15)32-3)19-14(11-26-21(28-19)22(23,24)25)20(29)27-13-6-8-16(31-2)18(10-13)33-4/h5-11H,1-4H3,(H,27,29) |
| InChIKey | WKJQIWSYDXRJIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide?
The IUPAC name of N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide (CID 142592630) is N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide.
What is the SMILES notation for N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide?
The canonical SMILES for N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide is COc1ccc(NC(=O)c2cnc(C(F)(F)F)nc2-c2ccc(OC)c(OC)c2)cc1OC.
What is the InChIKey of N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide?
The InChIKey is WKJQIWSYDXRJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F3N3O5/c1-30-15-7-5-12(9-17(15)32-3)19-14(11-26-21(28-19)22(23,24)25)20(29)27-13-6-8-16(31-2)18(10-13)33-4/h5-11H,1-4H3,(H,27,29).
What are the key properties of N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide?
N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide has a molecular weight of 463.41 g/mol, XLogP of 4.45, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide is sourced from PubChem (CID 142592630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).